Thảo luận trong 'Sim card-phụ kiện'

  1. dienthoaivoau01

    dienthoaivoau01 Member

    Bài viết:
    Đã được thích:
    BÁO GIÁ SỈ SIM NGÀY 10.01.2017





    SIM MOBI 11 SỐ TÀI KHOẢN 80-90K, NGOẠI MẠNG 50K + 4GB + 100 PHÚT + 100 TIN NHẮN, HẠN SỬ DỤNG 08/02/201770TEST

    SIM MOBI 11 SỐ TÀI KHOẢN 130K + 4GB + 100 PHÚT + 100 TIN NHẮN, HẠN SỬ DỤNG 28/02/201775TEST

    SIM MOBI 11 SỐ TÀI KHOẢN 160K + 4GB + 100 PHÚT + 100 TIN NHẮN, HẠN SỬ DỤNG 28/02/201777TEST

    SIM MOBI 11 SỐ TÀI KHOẢN 170K-180K, NGOẠI MẠNG 50K+ 4GB + 100 PHÚT + 100 TIN NHẮN, HẠN SỬ DỤNG 08/02/201779TEST

    SIM MOBI 11 SỐ TÀI KHOẢN 200K, NGOẠI MẠNG 50K+ 4GB + 100 PHÚT + 100 TIN NHẮN, HẠN SỬ DỤNG 08/02/201781TEST

    SIM MOBI 11 SỐ TÀI KHOẢN 230K, NGOẠI MẠNG 50K+ 4GB + 100 PHÚT + 100 TIN NHẮN, HẠN SỬ DỤNG 08/02/201786TEST

    SIM MOBI 11 SỐ TÀI KHOẢN 310K, NGOẠI MẠNG 80K+ 4GB + 200 PHÚT + 200 TIN NHẮN, HẠN SỬ DỤNG 28/02/201791TEST

    SIM MOBI 11 SỐ TÀI KHOẢN 350K-400K, NGOẠI MẠNG 100K+ 4GB + 200 PHÚT + 200 TIN NHẮN, HẠN SỬ DỤNG 28/02/2017105TEST

    SIM MOBI 11 SỐ TÀI KHOẢN 400K-450K, NGOẠI MẠNG 100K+ 4GB + 200 PHÚT + 200 TIN NHẮN, HẠN SỬ DỤNG 28/02/2017115TEST

    [b][b][b][b][b][b][b][b][b][b][b][b][b][b][b]SIM MOBI 11 SỐ TÀI KHOẢN 450K-500K, NGOẠI MẠNG 100K+ 4GB + 200 PHÚT + 200 TIN NHẮN, HẠN SỬ DỤNG 28/02/2017[/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b]125TEST

    SIM MOBI 10 SỐ 090, 090 TÀI KHOẢN 230K+ 4GB + 200 PHÚT + 200 TIN NHẮN, HẠN SỬ DỤNG 01/02/201786TEST

    SIM VINA TÀI KHOẢN 270K + 1.5GB + 1000 PHÚT65TEST


    ĐT : 0932-776-289 (ZALO) - Mr.VY
    0936-277-817 (ZALO)- Ms. HOA
    WEBSITE: - - - - -
    CÁCH 2 : Đặt hàng-chuyển khoản-nhận hàng. Ship free cho hóa đơn 3 triệu trở lên khu vực Gò Vấp, Phú Nhuận, Tân Bình, Q10, Q11.
    Sau khi chuyển khoản, quý khách hàng vui lòng nhắn tin vô sđt 0932-776-289 (Zalo) hoặc 0936-277-817 (Zalo) báo đã chuyển nha.

Chia sẻ trang này